Products 2089651-30-7

CAS 2089651-30-7 is the registry number for 4-(3-Methoxy-4-nitrophenyl)thiomorpholine 1-oxide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1-oxide (CAS 2089651-30-7) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1-oxide. InChIKey: RJBYKBRGGIJWEM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O4S
Molecular weight270.31 g/mol
IUPAC name4-(3-methoxy-4-nitrophenyl)-1,4-thiazinane 1-oxide
InChIKeyRJBYKBRGGIJWEM-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)N2CCS(=O)CC2)[N+](=O)[O-]

Computed by PubChem (NCBI)