cas: 759-24-0 — see every product listed under this CAS number, including other names
Diethyl 2-(tert-butyl)malonate, 95+% (CAS 759-24-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A668885-1g |
| cas | 759-24-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 525.70 Pln | |
| AmBeed | 250mg | 434.56 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Diethyl 2-tert-butylpropanedioate (CAS 759-24-0) is a chemical compound with the molecular formula C11H20O4 and a molecular weight of 216.27 g/mol. IUPAC name: diethyl 2-tert-butylpropanedioate. InChIKey: RJNICNBRGVKNSR-UHFFFAOYSA-N.
| Molecular formula | C11H20O4 |
|---|---|
| Molecular weight | 216.27 g/mol |
| IUPAC name | diethyl 2-tert-butylpropanedioate |
| InChIKey | RJNICNBRGVKNSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C |
Computed by PubChem (NCBI)