cas: 104097-04-3 — see every product listed under this CAS number, including other names
Diethyl 3-Nitrobenzylphosphonate 95+% (CAS 104097-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A368041-100mg |
| cas | 104097-04-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 503.88 Pln | |
| Ambeed | 5g | 1521.81 Pln | |
| Ambeed | 10g | 2734.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A368041 |
1-(diethoxyphosphorylmethyl)-3-nitrobenzene (CAS 104097-04-3) is a chemical compound with the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-nitrobenzene. InChIKey: QNHAEKQJZUMZFT-UHFFFAOYSA-N.
| Molecular formula | C11H16NO5P |
|---|---|
| Molecular weight | 273.22 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-nitrobenzene |
| InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=CC=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)