cas: 104097-04-3 — see every product listed under this CAS number, including other names
Phosphonic acid, P-[(3-nitrophenyl)methyl]-, diethyl ester, 95+%, 95+% (CAS 104097-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PFS-100mg |
| cas | 104097-04-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1173.20 Pln | |
| Chemat | 10g | 2104.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-(diethoxyphosphorylmethyl)-3-nitrobenzene (CAS 104097-04-3) is a chemical compound with the molecular formula C11H16NO5P and a molecular weight of 273.22 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-nitrobenzene. InChIKey: QNHAEKQJZUMZFT-UHFFFAOYSA-N.
| Molecular formula | C11H16NO5P |
|---|---|
| Molecular weight | 273.22 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-nitrobenzene |
| InChIKey | QNHAEKQJZUMZFT-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC(=CC=C1)[N+](=O)[O-])OCC |
Computed by PubChem (NCBI)