Diethyl 3-oxocyclopentane-1,1-dicarboxylate, 96%
cas: 180573-13-1 — see every product listed under this CAS number, including other names
Diethyl 3-oxocyclopentane-1,1-dicarboxylate, 96% (CAS 180573-13-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A156531-250mg |
| cas | 180573-13-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1260.38 Pln | |
| BLDpharm | 100mg | 386.56 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1352.88 Pln | |
| BLDpharm | 5g | 5034.92 Pln | |
| BLDpharm | 10g | 8772.49 Pln | |
| Fluorochem | 100mg | 617.51 Pln | |
| Fluorochem | 250mg | 888.25 Pln | |
| Fluorochem | 1g | 2075.33 Pln | |
| Fluorochem | 5g | 6854.90 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
Diethyl 3-oxocyclopentane-1,1-dicarboxylate (CAS 180573-13-1) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: diethyl 3-oxocyclopentane-1,1-dicarboxylate. InChIKey: XBSAEVIOKMQREK-UHFFFAOYSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | diethyl 3-oxocyclopentane-1,1-dicarboxylate |
| InChIKey | XBSAEVIOKMQREK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCC(=O)C1)C(=O)OCC |
Computed by PubChem (NCBI)