Products 156293-34-4
CAS 156293-34-4 is the registry number for Cis-4-oxo-1,2-cyclopentanedicarboxylic acid diethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate (CAS 156293-34-4) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate. InChIKey: GRPKMLGYFVVOJS-DTORHVGOSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | cis-diethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| InChIKey | GRPKMLGYFVVOJS-DTORHVGOSA-N |
| SMILES | CCOC(=O)[C@@H]1CC(=O)C[C@@H]1C(=O)OCC |
Computed by PubChem (NCBI)