CAS 2230799-23-0 appears in our catalog under these names: 4-(Ethoxycarbonyl)-3,3-dimethyl-2-oxabicyclo(2.1.1)hexane-1-carboxylic acid, 98%, 4-(Ethoxycarbonyl)-3,3-dimethyl-2-oxabicyclo(2.1.1)hexane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
4-ethoxycarbonyl-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid (CAS 2230799-23-0) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: 4-ethoxycarbonyl-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid. InChIKey: VSDUOEOJGIZQQF-UHFFFAOYSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-ethoxycarbonyl-3,3-dimethyl-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid |
| InChIKey | VSDUOEOJGIZQQF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C12CC(C1)(OC2(C)C)C(=O)O |
Computed by PubChem (NCBI)