CAS 221386-93-2 appears in our catalog under these names: Ethyl (1S,5R,6S)-5-(methoxymethoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate, 98%, Oseltamivir Impurity 92, Oseltamivir Impurity 106. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1S,5R,6S)-5-(methoxymethoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 221386-93-2) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: ethyl (1S,5R,6S)-5-(methoxymethoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: GXHDPVWKQGHHQE-KXUCPTDWSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | ethyl (1S,5R,6S)-5-(methoxymethoxy)-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | GXHDPVWKQGHHQE-KXUCPTDWSA-N |
| SMILES | CCOC(=O)C1=C[C@H]([C@@H]2[C@H](C1)O2)OCOC |
Computed by PubChem (NCBI)