CAS 97747-17-6 is the registry number for 3-O-Acetyl-4,6-o-isopropylidene-d-glucal, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[(4aR,8R,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate (CAS 97747-17-6) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: [(4aR,8R,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate. InChIKey: JSKNNUBJVJGXIN-BBBLOLIVSA-N.
| Molecular formula | C11H16O5 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | [(4aR,8R,8aS)-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl] acetate |
| InChIKey | JSKNNUBJVJGXIN-BBBLOLIVSA-N |
| SMILES | CC(=O)O[C@@H]1C=CO[C@H]2[C@H]1OC(OC2)(C)C |
Computed by PubChem (NCBI)