cas: 132616-34-3 — see every product listed under this CAS number, including other names
Diethyl spiro[3.3]heptane-2,6-dicarboxylate, 97%, 97% (CAS 132616-34-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121VW-100mg |
| cas | 132616-34-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 587.60 Pln | |
| Chemat | 500mg | 938.00 Pln | |
| Chemat | 1g | 1379.60 Pln | |
| Chemat | 5g | 3669.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Diethyl spiro[3.3]heptane-2,6-dicarboxylate (CAS 132616-34-3) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: diethyl spiro[3.3]heptane-2,6-dicarboxylate. InChIKey: GNJWXXQQMIJNDT-UHFFFAOYSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | diethyl spiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | GNJWXXQQMIJNDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(C1)CC(C2)C(=O)OCC |
Computed by PubChem (NCBI)