Products 340023-15-6

CAS 340023-15-6 is the registry number for 4-(2-Methoxycarbonylethyl)bicyclo[2.2.2]octane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(3-methoxy-3-oxopropyl)bicyclo[2.2.2]octane-1-carboxylic acid (CAS 340023-15-6) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: 4-(3-methoxy-3-oxopropyl)bicyclo[2.2.2]octane-1-carboxylic acid. InChIKey: ZFIIGRZPZQCDLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20O4
Molecular weight240.29 g/mol
IUPAC name4-(3-methoxy-3-oxopropyl)bicyclo[2.2.2]octane-1-carboxylic acid
InChIKeyZFIIGRZPZQCDLJ-UHFFFAOYSA-N
SMILESCOC(=O)CCC12CCC(CC1)(CC2)C(=O)O

Computed by PubChem (NCBI)