Products 1881293-10-2

CAS 1881293-10-2 is the registry number for 4-Hydroxy-4-methoxy-3-adamantane-1-carboxylic methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Methyl 4-hydroxy-4-methoxyadamantane-1-carboxylate (CAS 1881293-10-2) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: methyl 4-hydroxy-4-methoxyadamantane-1-carboxylate. InChIKey: YRQKBDYSRQPLPA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20O4
Molecular weight240.29 g/mol
IUPAC namemethyl 4-hydroxy-4-methoxyadamantane-1-carboxylate
InChIKeyYRQKBDYSRQPLPA-UHFFFAOYSA-N
SMILESCOC(=O)C12CC3CC(C1)C(C(C3)C2)(O)OC

Computed by PubChem (NCBI)