CAS 1881293-10-2 is the registry number for 4-Hydroxy-4-methoxy-3-adamantane-1-carboxylic methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-hydroxy-4-methoxyadamantane-1-carboxylate (CAS 1881293-10-2) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: methyl 4-hydroxy-4-methoxyadamantane-1-carboxylate. InChIKey: YRQKBDYSRQPLPA-UHFFFAOYSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | methyl 4-hydroxy-4-methoxyadamantane-1-carboxylate |
| InChIKey | YRQKBDYSRQPLPA-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C(C(C3)C2)(O)OC |
Computed by PubChem (NCBI)