Products 1234858-94-6
CAS 1234858-94-6 appears in our catalog under these names: Oseltamivir Impurity 62, (1R,5S,6S)-rel-5-(1-Ethylpropoxy)-7-oxabicyclo(4.1.0)hept-3-ene-3-carboxylic Acid Methyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
Methyl (1S,5R,6S)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate (CAS 1234858-94-6) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: methyl (1S,5R,6S)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate. InChIKey: BWNDCLRNSUNXGU-GRYCIOLGSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | methyl (1S,5R,6S)-5-pentan-3-yloxy-7-oxabicyclo[4.1.0]hept-3-ene-3-carboxylate |
| InChIKey | BWNDCLRNSUNXGU-GRYCIOLGSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@H]2[C@@H]1O2)C(=O)OC |
Computed by PubChem (NCBI)