Products 132616-34-3
CAS 132616-34-3 appears in our catalog under these names: Diethyl spiro[3.3]heptane-2,6-dicarboxylate, 95%, Diethyl spiro(3.3)heptane-2,6-dicarboxylate, 97%, Diethyl spiro[3.3]heptane-2,6-dicarboxylate, 97%, 97%, Diethyl spiro[3.3]heptane-2,6-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg, 500mg.
Diethyl spiro[3.3]heptane-2,6-dicarboxylate (CAS 132616-34-3) is a chemical compound with the molecular formula C13H20O4 and a molecular weight of 240.29 g/mol. IUPAC name: diethyl spiro[3.3]heptane-2,6-dicarboxylate. InChIKey: GNJWXXQQMIJNDT-UHFFFAOYSA-N.
| Molecular formula | C13H20O4 |
|---|---|
| Molecular weight | 240.29 g/mol |
| IUPAC name | diethyl spiro[3.3]heptane-2,6-dicarboxylate |
| InChIKey | GNJWXXQQMIJNDT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2(C1)CC(C2)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
Diethyl spiro[3.3]heptane-2,6-dicarboxylate, 2,6-diethyl spiro[3.3]heptane-2,6-dicarboxylate, Spiro[3.3]heptane-2,6-dicarboxylic acid diethyl ester, Diethylspiro[3.3]heptane-2,6-dicarboxylate, Spiro[3.3]heptane-2,6-dicarboxylic acid, 2,6-diethyl ester, Spiro[3.3]heptane-2,6-dicarboxylic acid,, Spiro[3.3]heptane-2,6-dicarboxylicacid diethyl ester