cas: 120-55-8 — see every product listed under this CAS number, including other names
Diethylene Glycol Dibenzoate, >97.0%(GC) (CAS 120-55-8) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 500ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1522-25ML |
| cas | 120-55-8 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 113.43 Pln | |
| TCI | 500ml | 954.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
2-(2-benzoyloxyethoxy)ethyl benzoate (CAS 120-55-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 2-(2-benzoyloxyethoxy)ethyl benzoate. InChIKey: NXQMCAOPTPLPRL-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-(2-benzoyloxyethoxy)ethyl benzoate |
| InChIKey | NXQMCAOPTPLPRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCOCCOC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)