cas: 120-55-8 — see every product listed under this CAS number, including other names
Oxybis(ethane-2,1-diyl) dibenzoate 90% (CAS 120-55-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A591033-25g |
| cas | 120-55-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 120.06 Pln | |
| Ambeed | 100g | 170.12 Pln | |
| Ambeed | 500g | 314.75 Pln | |
| Ambeed | 1000g | 464.94 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A591033 |
2-(2-benzoyloxyethoxy)ethyl benzoate (CAS 120-55-8) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 2-(2-benzoyloxyethoxy)ethyl benzoate. InChIKey: NXQMCAOPTPLPRL-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-(2-benzoyloxyethoxy)ethyl benzoate |
| InChIKey | NXQMCAOPTPLPRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCCOCCOC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)