Products 20213-26-7
CAS 20213-26-7 appears in our catalog under these names: Dihydrolapachenole, Dihydrolapachenole/ 99.75% (existing batch purity), Dihydrolapachenole, 98.57%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 100mg, 50mg, 1 mg, 5 mg.
6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene (CAS 20213-26-7) is a chemical compound with the molecular formula C16H18O2 and a molecular weight of 242.31 g/mol. IUPAC name: 6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene. InChIKey: OZVDAMFCGBFOHR-UHFFFAOYSA-N.
| Molecular formula | C16H18O2 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | 6-methoxy-2,2-dimethyl-3,4-dihydrobenzo[h]chromene |
| InChIKey | OZVDAMFCGBFOHR-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C3=CC=CC=C3C(=C2)OC)C |
Computed by PubChem (NCBI)