Dimethyl (2R,3R)-2,3-dihydroxysuccinate, 97%
cas: 608-68-4 — see every product listed under this CAS number, including other names
Dimethyl (2R,3R)-2,3-dihydroxysuccinate, 97% (CAS 608-68-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A694721-5g |
| cas | 608-68-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 314.75 Pln | |
| Ambeed | 500g | 1176.94 Pln | |
| Ambeed | 1kg | 2272.75 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 203.29 Pln | |
| BLDpharm | 100g | 331.02 Pln | |
| BLDpharm | 500g | 1264.02 Pln | |
| BLDpharm | 1kg | 2441.39 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Dimethyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 608-68-4) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-QWWZWVQMSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl L-tartrate, L-DIMETHYL TARTRATE, Dimethyl (R(R*,R*))-tartrate, Dimethyl [R(R*,R*)]-tartrate, L(+)tartaric acid dimethyl ester, LDimethyl tartrate, (+)Dimethyl Ltartrate, Dimethyl (R(R*,R*))tartrate, 1,4-Dimethyl 2,3-dihydroxy-(2R,3R)butanedioate, Butanedioic acid, 2,3dihydroxy (2R,3R), dimethyl ester
