cas: 608-68-4 — see every product listed under this CAS number, including other names
(+)-Dimethyl L-tartrate, 98+% (CAS 608-68-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 172490250 |
| cas | 608-68-4 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 134.08 Pln | |
| Thermo Scientific (Acros) | 100g | 331.86 Pln | |
| Thermo Scientific (Acros) | 500g | 1518.97 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98+% |
Dimethyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 608-68-4) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-QWWZWVQMSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)