CAS 63104-44-9 appears in our catalog under these names: Dimethyl Dipropargylmalonate, Dimethyl Dipropargylmalonate, >98.0%(GC), Propanedioic acid, 2,2-di-2-propyn-1-yl-, 1,3-dimethyl ester, 97%, 97%, 2,2-DI-(PROP-2-YNYL)-MALONIC ACID DIMETHYL ESTER, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
Dimethyl 2,2-bis(prop-2-ynyl)propanedioate (CAS 63104-44-9) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: dimethyl 2,2-bis(prop-2-ynyl)propanedioate. InChIKey: AKISDSWMEPTCRL-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | dimethyl 2,2-bis(prop-2-ynyl)propanedioate |
| InChIKey | AKISDSWMEPTCRL-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC#C)(CC#C)C(=O)OC |
Computed by PubChem (NCBI)