Dimethyl 3,3'-diamino-[1,1'-biphenyl]-4,4'-dicarboxylate, 95%
cas: 2101636-49-9 — see every product listed under this CAS number, including other names
Dimethyl 3,3'-diamino-[1,1'-biphenyl]-4,4'-dicarboxylate, 95% (CAS 2101636-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1809657-250mg |
| cas | 2101636-49-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1583.00 Pln | |
| Ambeed | 5g | 5354.38 Pln | |
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1235.60 Pln | |
| Chemat | 5g | 4163.60 Pln | |
| BLDpharm | 100mg | 408.77 Pln | |
| BLDpharm | 250mg | 625.36 Pln | |
| BLDpharm | 1g | 1552.81 Pln | |
| BLDpharm | 5g | 5251.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-amino-4-(3-amino-4-methoxycarbonylphenyl)benzoate (CAS 2101636-49-9) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: methyl 2-amino-4-(3-amino-4-methoxycarbonylphenyl)benzoate. InChIKey: GVQPQAMGMIGQKK-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | methyl 2-amino-4-(3-amino-4-methoxycarbonylphenyl)benzoate |
| InChIKey | GVQPQAMGMIGQKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=C(C=C2)C(=O)OC)N)N |
Computed by PubChem (NCBI)