CAS 312921-97-4 is the registry number for Ethyl 4-(benzylamino)-3-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl 4-(benzylamino)-3-nitrobenzoate (CAS 312921-97-4) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: ethyl 4-(benzylamino)-3-nitrobenzoate. InChIKey: BKWSCURTPBKAMU-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | ethyl 4-(benzylamino)-3-nitrobenzoate |
| InChIKey | BKWSCURTPBKAMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)NCC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)