CAS 5394-50-3 appears in our catalog under these names: Dibenzyl hydrazodicarboxylate, Dibenzyl hydrazine-1,2-dicarboxylate, 98%, Linezolid Impurity 52, Dibenzyl hydrazine-1,2-dicarboxylate, Dibenzyl hydrazodicarboxylate 99%. Offered by: GLPBio, Combi-blocks, Chemat Brand, Biosynth, Ambeed. Available pack sizes: 50mg, 5g, 1g, 25g, 10g, on request, 10mg, 100mg.
Benzyl N-(phenylmethoxycarbonylamino)carbamate (CAS 5394-50-3) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: benzyl N-(phenylmethoxycarbonylamino)carbamate. InChIKey: UEYMRBONTZTXQP-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | benzyl N-(phenylmethoxycarbonylamino)carbamate |
| InChIKey | UEYMRBONTZTXQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)