CAS 98966-14-4 appears in our catalog under these names: Acetaminophen Dimer, Acetaminophen Dimer, N,N'-(6,6'-Dihydroxy-[1,1'-biphenyl]-3,3'-diyl)diacetamide, 95%, 95%, Acetamide, N,N'-(6,6'-dihydroxy[1,1'-biphenyl]-3,3'-diyl)bis-, 95%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 25mg, 100mg, 5mg.
N-[3-(5-acetamido-2-hydroxyphenyl)-4-hydroxyphenyl]acetamide (CAS 98966-14-4) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: N-[3-(5-acetamido-2-hydroxyphenyl)-4-hydroxyphenyl]acetamide. InChIKey: PHJCCQZHFLRCAA-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | N-[3-(5-acetamido-2-hydroxyphenyl)-4-hydroxyphenyl]acetamide |
| InChIKey | PHJCCQZHFLRCAA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)NC(=O)C)O |
Computed by PubChem (NCBI)