CAS 3789-93-3 is the registry number for 2,2'-Diamino-6,6'-dimethyl-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-4-(2-amino-4-carboxy-6-methylphenyl)-5-methylbenzoic acid (CAS 3789-93-3) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: 3-amino-4-(2-amino-4-carboxy-6-methylphenyl)-5-methylbenzoic acid. InChIKey: CCDHALRZAVADNC-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | 3-amino-4-(2-amino-4-carboxy-6-methylphenyl)-5-methylbenzoic acid |
| InChIKey | CCDHALRZAVADNC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C2=C(C=C(C=C2C)C(=O)O)N)N)C(=O)O |
Computed by PubChem (NCBI)