CAS 149935-34-2 appears in our catalog under these names: Dimethyl 4,4'-diamino-[1,1'-biphenyl]-2,2'-dicarboxylate, 97%, 97%, Dimethyl 4,4'-diamino-[1,1'-biphenyl]-2,2'-dicarboxylate, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Methyl 5-amino-2-(4-amino-2-methoxycarbonylphenyl)benzoate (CAS 149935-34-2) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: methyl 5-amino-2-(4-amino-2-methoxycarbonylphenyl)benzoate. InChIKey: BFLXALDUYUICLW-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | methyl 5-amino-2-(4-amino-2-methoxycarbonylphenyl)benzoate |
| InChIKey | BFLXALDUYUICLW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)C(=O)OC |
Computed by PubChem (NCBI)