cas: 71932-29-1 — see every product listed under this CAS number, including other names
Dimethyl 4-Acetoxyisophthalate, >98.0%(GC) (CAS 71932-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1226-1G |
| cas | 71932-29-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 452.72 Pln | |
| TCI | 5g | 1652.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Dimethyl 4-acetyloxybenzene-1,3-dicarboxylate (CAS 71932-29-1) is a chemical compound with the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. IUPAC name: dimethyl 4-acetyloxybenzene-1,3-dicarboxylate. InChIKey: MZBAKPXGINZGLK-UHFFFAOYSA-N.
| Molecular formula | C12H12O6 |
|---|---|
| Molecular weight | 252.22 g/mol |
| IUPAC name | dimethyl 4-acetyloxybenzene-1,3-dicarboxylate |
| InChIKey | MZBAKPXGINZGLK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)