cas: 99-27-4 — see every product listed under this CAS number, including other names
Dimethyl 5-aminoisophthalate 98% (CAS 99-27-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175879-5g |
| cas | 99-27-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 409.31 Pln | |
| Ambeed | 500g | 1432.81 Pln | |
| Ambeed | 1000g | 2384.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175879 |
Dimethyl 5-aminobenzene-1,3-dicarboxylate (CAS 99-27-4) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: dimethyl 5-aminobenzene-1,3-dicarboxylate. InChIKey: DEKPYXUDJRABNK-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | dimethyl 5-aminobenzene-1,3-dicarboxylate |
| InChIKey | DEKPYXUDJRABNK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)N)C(=O)OC |
Computed by PubChem (NCBI)