CAS 164073-80-7 appears in our catalog under these names: Dimethyl 5–formylisophthalate, Dimethyl 5-formylisophthalate, 97%, 97%, DIMETHYL 5-FORMYLISOPHTHALATE, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Dimethyl 5-formylbenzene-1,3-dicarboxylate (CAS 164073-80-7) is a chemical compound with the molecular formula C11H10O5 and a molecular weight of 222.19 g/mol. IUPAC name: dimethyl 5-formylbenzene-1,3-dicarboxylate. InChIKey: CNOSLEHLXKSKSH-UHFFFAOYSA-N.
| Molecular formula | C11H10O5 |
|---|---|
| Molecular weight | 222.19 g/mol |
| IUPAC name | dimethyl 5-formylbenzene-1,3-dicarboxylate |
| InChIKey | CNOSLEHLXKSKSH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C=O)C(=O)OC |
Computed by PubChem (NCBI)