cas: 1829-60-3 — see every product listed under this CAS number, including other names
Dimethyl 7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate, >95.0%(GC) (CAS 1829-60-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4414-1G |
| cas | 1829-60-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 192.10 Pln | |
| TCI | 5g | 590.40 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
Dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (CAS 1829-60-3) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate. InChIKey: FQVSHUVBNGSEJO-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| InChIKey | FQVSHUVBNGSEJO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2C=CC1O2)C(=O)OC |
Computed by PubChem (NCBI)