cas: 1829-60-3 — see every product listed under this CAS number, including other names
Dimethyl 7-Oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (CAS 1829-60-3) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQG3-200mg |
| cas | 1829-60-3 |
| size | 200mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 122.00 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Chemat | 25g | 2109.20 Pln |
| delivery time | 3 weeks |
|---|
Dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (CAS 1829-60-3) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate. InChIKey: FQVSHUVBNGSEJO-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | dimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| InChIKey | FQVSHUVBNGSEJO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2C=CC1O2)C(=O)OC |
Computed by PubChem (NCBI)