cas: 1459-96-7 — see every product listed under this CAS number, including other names
Dimethyl Bicyclo[2.2.2]octane-1,4-dicarboxylate, >95%, >95% (CAS 1459-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DI6-250mg |
| cas | 1459-96-7 |
| size | 250mg |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 266.00 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 50g | 923.60 Pln | |
| Chemat | 100g | 1562.00 Pln | |
| Chemat | 250g | 3645.20 Pln | |
| Chemat | 500g | 6676.80 Pln | |
| Chemat | 1kg | 11901.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate (CAS 1459-96-7) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate. InChIKey: HDOVTVDGSLEUSK-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate |
| InChIKey | HDOVTVDGSLEUSK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCC(CC1)(CC2)C(=O)OC |
Computed by PubChem (NCBI)