CAS 4841-85-4 appears in our catalog under these names: Diethyl cis–4–Cyclohexene–1,2–dicarboxylate, Diethyl cis-4-Cyclohexene-1,2-dicarboxylate, >98.0%(GC), Cis-4-Cyclohexene-1,2-Dicarboxylic Acid Diethyl Ester, Cis-4-cyclohexene-1,2-dicarboxylic acid diethyl ester, 95%, CIS-4-CYCLOHEXENE-1,2-DICARBOXYLIC ACID DIETHYL ESTER, ≥98%(GC). Offered by: GLPBio, TCI, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
Diethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate (CAS 4841-85-4) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: diethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate. InChIKey: OWVOHDKOANTMJU-AOOOYVTPSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | diethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | OWVOHDKOANTMJU-AOOOYVTPSA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CC[C@@H]1C(=O)OCC |
Computed by PubChem (NCBI)