cas: 27025-25-8 — see every product listed under this CAS number, including other names
Dimethyl D-glutamate hydrochloride, 98%, 98% (CAS 27025-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145ZE-1g |
| cas | 27025-25-8 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 98.00 Pln | |
| Chemat | 100g | 189.20 Pln | |
| Chemat | 250g | 366.80 Pln | |
| Chemat | 500g | 705.60 Pln | |
| Chemat | 1kg | 1139.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dimethyl (2R)-2-aminopentanedioate;hydrochloride (CAS 27025-25-8) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: dimethyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: MFUPLHQOVIUESQ-NUBCRITNSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | dimethyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | MFUPLHQOVIUESQ-NUBCRITNSA-N |
| SMILES | COC(=O)CC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)