cas: 27025-25-8 — see every product listed under this CAS number, including other names
H-D-Glu(OMe)-OMe·HCl 97% (CAS 27025-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144542-1000g |
| cas | 27025-25-8 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 1911.19 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 298.06 Pln | |
| Ambeed | 500g | 1215.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144542 |
Dimethyl (2R)-2-aminopentanedioate;hydrochloride (CAS 27025-25-8) is a chemical compound with the molecular formula C7H14ClNO4 and a molecular weight of 211.64 g/mol. IUPAC name: dimethyl (2R)-2-aminopentanedioate;hydrochloride. InChIKey: MFUPLHQOVIUESQ-NUBCRITNSA-N.
| Molecular formula | C7H14ClNO4 |
|---|---|
| Molecular weight | 211.64 g/mol |
| IUPAC name | dimethyl (2R)-2-aminopentanedioate;hydrochloride |
| InChIKey | MFUPLHQOVIUESQ-NUBCRITNSA-N |
| SMILES | COC(=O)CC[C@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)