Products 693241-54-2
CAS 693241-54-2 appears in our catalog under these names: 2-((4-[(2-METHOXYBENZOYL)AMINO]BENZOYL)AMINO)BENZOIC ACID, ≥98%, EG1, EG1/ 97.73% (existing batch purity), EG1 99%, EG1, 99%, 99%. Offered by: Fluorochem, GLPBio, TargetMol, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1mg, 2mg, 5mg, 200mg.
2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid (CAS 693241-54-2) is a chemical compound with the molecular formula C22H18N2O5 and a molecular weight of 390.4 g/mol. IUPAC name: 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid. InChIKey: GYZZRJRJYVMXNS-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic acid |
| InChIKey | GYZZRJRJYVMXNS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)NC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-(2-Methoxybenzamido)benzamido)benzoic acid, 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]benzoic Acid, 2-((4-[(2-methoxybenzoyl)amino]benzoyl)amino)benzoic acid, Pax2 inhibitor EG1, Pax2 inhibitor EG1?, (Pax2 inhibitor EG1), orb1217725, orb1305108, 2-[[4-[(2-Methoxybenzoyl)amino]benzoyl]amino]-benzoic acid, Benzoic acid, 2-[[4-[(2-methoxybenzoyl)amino]benzoyl]amino]-