Products 263744-72-5
CAS 263744-72-5 appears in our catalog under these names: EMDT/ 98.33% (existing batch purity), EMDT oxalate, EMDT oxalate. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg.
2-(2-ethyl-5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine;oxalic acid (CAS 263744-72-5) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: 2-(2-ethyl-5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine;oxalic acid. InChIKey: IFGWAHGHGDZBEH-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 2-(2-ethyl-5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine;oxalic acid |
| InChIKey | IFGWAHGHGDZBEH-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N1)C=CC(=C2)OC)CCN(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)