cas: 5463-22-9 — see every product listed under this CAS number, including other names
ETHANEDIONE, BIS(4-HYDROXY-3-METHOXYPHENYL)-, 95%, 95% (CAS 5463-22-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148A8-25mg |
| cas | 5463-22-9 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 611.60 Pln | |
| Chemat | 100mg | 1715.60 Pln | |
| Chemat | 250mg | 3851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione (CAS 5463-22-9) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione. InChIKey: MJHMXBDRUWSJOS-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 1,2-bis(4-hydroxy-3-methoxyphenyl)ethane-1,2-dione |
| InChIKey | MJHMXBDRUWSJOS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)C(=O)C2=CC(=C(C=C2)O)OC)O |
Computed by PubChem (NCBI)