cas: 414873-13-5 — see every product listed under this CAS number, including other names
ETHYL 1-(3-NITROBENZYL)PIPERIDINE-4-CARBOXYLATE, 97%, 97% (CAS 414873-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12XGE1-100mg |
| cas | 414873-13-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 1-[(3-nitrophenyl)methyl]piperidine-4-carboxylate (CAS 414873-13-5) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: ethyl 1-[(3-nitrophenyl)methyl]piperidine-4-carboxylate. InChIKey: UGBJPCXWAAKYKZ-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | ethyl 1-[(3-nitrophenyl)methyl]piperidine-4-carboxylate |
| InChIKey | UGBJPCXWAAKYKZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)CC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)