cas: 886369-79-5 — see every product listed under this CAS number, including other names
ETHYL 2-(3-FLUOROPHENYL)THIAZOLE-5-CARBOXYLATE, 98% (CAS 886369-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471645-100MG |
| cas | 886369-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 534.20 Pln | |
| Fluorochem | 1g | 1351.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate (CAS 886369-79-5) is a chemical compound with the molecular formula C12H10FNO2S and a molecular weight of 251.28 g/mol. IUPAC name: ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate. InChIKey: PIIGTUHXTVQOFW-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO2S |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | ethyl 2-(3-fluorophenyl)-1,3-thiazole-5-carboxylate |
| InChIKey | PIIGTUHXTVQOFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(S1)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)