cas: 139911-30-1 — see every product listed under this CAS number, including other names
ETHYL 2-CHLORO-5-FLUOROPYRIDINE-3-CARBOXYLATE, 98% (CAS 139911-30-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306685-1G |
| cas | 139911-30-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 810.15 Pln | |
| Fluorochem | 10g | 1309.97 Pln | |
| Fluorochem | 25g | 2299.21 Pln | |
| Fluorochem | 50g | 3798.68 Pln | |
| Fluorochem | 100g | 6292.59 Pln | |
| Fluorochem | 250g | 15034.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-chloro-5-fluoropyridine-3-carboxylate (CAS 139911-30-1) is a chemical compound with the molecular formula C8H7ClFNO2 and a molecular weight of 203.60 g/mol. IUPAC name: ethyl 2-chloro-5-fluoropyridine-3-carboxylate. InChIKey: ZCQJBYHGMYTQAO-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO2 |
|---|---|
| Molecular weight | 203.60 g/mol |
| IUPAC name | ethyl 2-chloro-5-fluoropyridine-3-carboxylate |
| InChIKey | ZCQJBYHGMYTQAO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)F)Cl |
Computed by PubChem (NCBI)