cas: 1071788-87-8 — see every product listed under this CAS number, including other names
ETHYL 3-(4-HYDROXYPHENYL)-5-METHYLISOXAZOLE-4-CARBOXYLATE (CAS 1071788-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387471-250MG |
| cas | 1071788-87-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1034.03 Pln | |
| Fluorochem | 1g | 2434.58 Pln | |
| Fluorochem | 5g | 7292.24 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1071788-87-8) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: RMSISQARGKWFFF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | RMSISQARGKWFFF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=CC=C(C=C2)O)C |
Computed by PubChem (NCBI)