cas: 1071788-87-8 — see every product listed under this CAS number, including other names
Ethyl 3-(4-Hydroxyphenyl)-5-methylisoxazole-4-carboxylate, >97%, >97% (CAS 1071788-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q6Y-250mg |
| cas | 1071788-87-8 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1485.20 Pln | |
| Chemat | 5g | 4418.00 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1071788-87-8) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: RMSISQARGKWFFF-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | ethyl 3-(4-hydroxyphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | RMSISQARGKWFFF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=CC=C(C=C2)O)C |
Computed by PubChem (NCBI)