cas: 168473-88-9 — see every product listed under this CAS number, including other names
ETHYL 3-AMINO-4-BROMOBENZOATE, 98% (CAS 168473-88-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F535610-250MG |
| cas | 168473-88-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1372.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-amino-4-bromobenzoate (CAS 168473-88-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 3-amino-4-bromobenzoate. InChIKey: PPVXNRMIVXWQKP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 3-amino-4-bromobenzoate |
| InChIKey | PPVXNRMIVXWQKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)