Products 168473-88-9
CAS 168473-88-9 appears in our catalog under these names: Ethyl 3-amino-4-bromobenzoate, 96%, Ethyl 3-amino-4-bromobenzoate 98%, Ethyl 3-amino-4-bromobenzoate, 98%, 98%, ETHYL 3-AMINO-4-BROMOBENZOATE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Ethyl 3-amino-4-bromobenzoate (CAS 168473-88-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: ethyl 3-amino-4-bromobenzoate. InChIKey: PPVXNRMIVXWQKP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | ethyl 3-amino-4-bromobenzoate |
| InChIKey | PPVXNRMIVXWQKP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)Br)N |
Computed by PubChem (NCBI)