cas: 5556-20-7 — see every product listed under this CAS number, including other names
ETHYL 3-HYDROXYBENZO[B]THIOPHENE-2-CARBOXYLATE, 97% (CAS 5556-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472442-100MG |
| cas | 5556-20-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 476.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 3-hydroxy-1-benzothiophene-2-carboxylate (CAS 5556-20-7) is a chemical compound with the molecular formula C11H10O3S and a molecular weight of 222.26 g/mol. IUPAC name: ethyl 3-hydroxy-1-benzothiophene-2-carboxylate. InChIKey: KRXONUVWZRBHQR-UHFFFAOYSA-N.
| Molecular formula | C11H10O3S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | ethyl 3-hydroxy-1-benzothiophene-2-carboxylate |
| InChIKey | KRXONUVWZRBHQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=CC=CC=C2S1)O |
Computed by PubChem (NCBI)