cas: 1261885-66-8 — see every product listed under this CAS number, including other names
ETHYL 4-AZAINDOLE-6-CARBOXYLATE, 98% (CAS 1261885-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468138-100MG |
| cas | 1261885-66-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 500mg | 549.82 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 607.10 Pln | |
| Fluorochem | 10g | 700.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate (CAS 1261885-66-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate. InChIKey: NAJRZBFAOZOKDX-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | ethyl 1H-pyrrolo[3,2-b]pyridine-6-carboxylate |
| InChIKey | NAJRZBFAOZOKDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CN2)N=C1 |
Computed by PubChem (NCBI)