CAS 773139-40-5 appears in our catalog under these names: Ethyl 4-bromo-2,3,6-trifluorobenzoate, 97%, Ethyl 4-Bromo-2,3,6-trifluorobenzoate, ≥95%, ≥95%, ETHYL 4-BROMO-2,3,6-TRIFLUOROBENZOATE, ≥95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
Ethyl 4-bromo-2,3,6-trifluorobenzoate (CAS 773139-40-5) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: ethyl 4-bromo-2,3,6-trifluorobenzoate. InChIKey: RFKJIIUJJBBPFC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | ethyl 4-bromo-2,3,6-trifluorobenzoate |
| InChIKey | RFKJIIUJJBBPFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(C=C1F)Br)F)F |
Computed by PubChem (NCBI)