cas: 51135-70-7 — see every product listed under this CAS number, including other names
ETHYL 5-METHYLPYRAZOLO[1,5-A]PYRIDINE-3-CARBOXYLATE, 95% (CAS 51135-70-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F330775-5G |
| cas | 51135-70-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2028.47 Pln | |
| Chemat | 1g | 390.80 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 10g | 4532.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate (CAS 51135-70-7) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: DQUKVLJJYYYMFC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | DQUKVLJJYYYMFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=C(C=CN2N=C1)C |
Computed by PubChem (NCBI)