cas: 51135-70-7 — see every product listed under this CAS number, including other names
Ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate 95% (CAS 51135-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A242021-100mg |
| cas | 51135-70-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 476.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A242021 |
Ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate (CAS 51135-70-7) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate. InChIKey: DQUKVLJJYYYMFC-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 5-methylpyrazolo[1,5-a]pyridine-3-carboxylate |
| InChIKey | DQUKVLJJYYYMFC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=C(C=CN2N=C1)C |
Computed by PubChem (NCBI)